C13H24OS2 — CID 79972462
(3,5-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol (PubChem CID 79972462) has the molecular formula C13H24OS2 and a molecular weight of 260.47 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol.
| Compound Name | (3,5-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol |
|---|---|
| PubChem CID | 79972462 |
| Molecular Formula | C13H24OS2 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (3,5-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol |
| SMILES | CC1CC(C)CC(C(O)C2CSCCS2)C1 |
| InChI | InChI=1S/C13H24OS2/c1-9-5-10(2)7-11(6-9)13(14)12-8-15-3-4-16-12/h9-14H,3-8H2,1-2H3 |
| InChIKey | ULTVOEQXRANEMI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |