C12H22OS2 — CID 79973457
1,4-dithian-2-yl-(4-methylcyclohexyl)methanol (PubChem CID 79973457) has the molecular formula C12H22OS2 and a molecular weight of 246.44 g/mol. Its IUPAC name is 1,4-dithian-2-yl-(4-methylcyclohexyl)methanol.
| Compound Name | 1,4-dithian-2-yl-(4-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 79973457 |
| Molecular Formula | C12H22OS2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1,4-dithian-2-yl-(4-methylcyclohexyl)methanol |
| SMILES | CC1CCC(C(O)C2CSCCS2)CC1 |
| InChI | InChI=1S/C12H22OS2/c1-9-2-4-10(5-3-9)12(13)11-8-14-6-7-15-11/h9-13H,2-8H2,1H3 |
| InChIKey | JCDSDPREGDEMHC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |