C12H23NS2 — CID 82932305
cycloheptyl(1,4-dithian-2-yl)methanamine (PubChem CID 82932305) has the molecular formula C12H23NS2 and a molecular weight of 245.46 g/mol. Its IUPAC name is cycloheptyl(1,4-dithian-2-yl)methanamine.
| Compound Name | cycloheptyl(1,4-dithian-2-yl)methanamine |
|---|---|
| PubChem CID | 82932305 |
| Molecular Formula | C12H23NS2 |
| Molecular Weight | 245.46 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | cycloheptyl(1,4-dithian-2-yl)methanamine |
| SMILES | NC(C1CCCCCC1)C1CSCCS1 |
| InChI | InChI=1S/C12H23NS2/c13-12(11-9-14-7-8-15-11)10-5-3-1-2-4-6-10/h10-12H,1-9,13H2 |
| InChIKey | WQQPSZIZKQFXNX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |