C9H18N2OS2 — CID 105249196
[1,4-dithian-2-yl(oxolan-3-yl)methyl]hydrazine (PubChem CID 105249196) has the molecular formula C9H18N2OS2 and a molecular weight of 234.39 g/mol. Its IUPAC name is [1,4-dithian-2-yl(oxolan-3-yl)methyl]hydrazine.
| Compound Name | [1,4-dithian-2-yl(oxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105249196 |
| Molecular Formula | C9H18N2OS2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [1,4-dithian-2-yl(oxolan-3-yl)methyl]hydrazine |
| SMILES | NNC(C1CCOC1)C1CSCCS1 |
| InChI | InChI=1S/C9H18N2OS2/c10-11-9(7-1-2-12-5-7)8-6-13-3-4-14-8/h7-9,11H,1-6,10H2 |
| InChIKey | HEAUQWLPYGNKHU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|