C10H19NS2 — CID 79972497
cyclopentyl(1,4-dithian-2-yl)methanamine (PubChem CID 79972497) has the molecular formula C10H19NS2 and a molecular weight of 217.40 g/mol. Its IUPAC name is cyclopentyl(1,4-dithian-2-yl)methanamine.
| Compound Name | cyclopentyl(1,4-dithian-2-yl)methanamine |
|---|---|
| PubChem CID | 79972497 |
| Molecular Formula | C10H19NS2 |
| Molecular Weight | 217.40 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | cyclopentyl(1,4-dithian-2-yl)methanamine |
| SMILES | NC(C1CCCC1)C1CSCCS1 |
| InChI | InChI=1S/C10H19NS2/c11-10(8-3-1-2-4-8)9-7-12-5-6-13-9/h8-10H,1-7,11H2 |
| InChIKey | WZSHAOZPCZZFPS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |