C11H22O2 — CID 103452734
1-(3,5-dimethylcyclohexyl)propane-1,2-diol (PubChem CID 103452734) has the molecular formula C11H22O2 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)propane-1,2-diol.
| Compound Name | 1-(3,5-dimethylcyclohexyl)propane-1,2-diol |
|---|---|
| PubChem CID | 103452734 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)propane-1,2-diol |
| SMILES | CC1CC(C)CC(C(O)C(C)O)C1 |
| InChI | InChI=1S/C11H22O2/c1-7-4-8(2)6-10(5-7)11(13)9(3)12/h7-13H,4-6H2,1-3H3 |
| InChIKey | JHFORSMJKBVESX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |