About cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane
cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane (PubChem CID 130223743) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane.
Molecular Properties
| Compound Name | cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane |
| PubChem CID | 130223743 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane |
| SMILES | CC(C)OC1C[C@@H](C)C[C@@H](C)C1 |
| InChI | InChI=1S/C11H22O/c1-8(2)12-11-6-9(3)5-10(4)7-11/h8-11H,5-7H2,1-4H3/t9-,10+,11? |
| InChIKey | UPVRGPGHCXCQFH-ZACCUICWSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane?
The IUPAC name of cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane (CID 130223743) is cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane.
What is the SMILES notation for cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane?
The canonical SMILES for cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane is CC(C)OC1C[C@@H](C)C[C@@H](C)C1.
What is the InChIKey of cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane?
The InChIKey is UPVRGPGHCXCQFH-ZACCUICWSA-N. The full InChI is InChI=1S/C11H22O/c1-8(2)12-11-6-9(3)5-10(4)7-11/h8-11H,5-7H2,1-4H3/t9-,10+,11?.
What are the key properties of cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane?
cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane has a molecular weight of 170.30 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane is sourced from PubChem (CID 130223743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).