C11H22O — CID 130223743
cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane (PubChem CID 130223743) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane.
| Compound Name | cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane |
|---|---|
| PubChem CID | 130223743 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | cis-(1S,3R)-1,3-dimethyl-5-propan-2-yloxycyclohexane |
| SMILES | CC(C)OC1C[C@@H](C)C[C@@H](C)C1 |
| InChI | InChI=1S/C11H22O/c1-8(2)12-11-6-9(3)5-10(4)7-11/h8-11H,5-7H2,1-4H3/t9-,10+,11? |
| InChIKey | UPVRGPGHCXCQFH-ZACCUICWSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |