C9H18S5 — CID 22238756
1-[4-(1-sulfanylpropyl)-1,3,5-trithian-2-yl]propane-1-thiol (PubChem CID 22238756) has the molecular formula C9H18S5 and a molecular weight of 286.58 g/mol. Its IUPAC name is 1-[4-(1-sulfanylpropyl)-1,3,5-trithian-2-yl]propane-1-thiol.
| Compound Name | 1-[4-(1-sulfanylpropyl)-1,3,5-trithian-2-yl]propane-1-thiol |
|---|---|
| PubChem CID | 22238756 |
| Molecular Formula | C9H18S5 |
| Molecular Weight | 286.58 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 1-[4-(1-sulfanylpropyl)-1,3,5-trithian-2-yl]propane-1-thiol |
| SMILES | CCC(S)C1SCSC(C(S)CC)S1 |
| InChI | InChI=1S/C9H18S5/c1-3-6(10)8-12-5-13-9(14-8)7(11)4-2/h6-11H,3-5H2,1-2H3 |
| InChIKey | CQONOEPQBJRAQU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|