About S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate
S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate (PubChem CID 22670176) has the molecular formula C10H16OS4
and a molecular weight of 280.50 g/mol. Its IUPAC name is S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate.
Molecular Properties
| Compound Name | S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate |
| PubChem CID | 22670176 |
| Molecular Formula | C10H16OS4 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCSCCCC1CSCS1 |
| InChI | InChI=1S/C10H16OS4/c1-2-10(11)15-7-12-5-3-4-9-6-13-8-14-9/h2,9H,1,3-8H2 |
| InChIKey | IDEDAMGIXCVPLJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate?
The IUPAC name of S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate (CID 22670176) is S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate.
What is the SMILES notation for S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate?
The canonical SMILES for S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate is C=CC(=O)SCSCCCC1CSCS1.
What is the InChIKey of S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate?
The InChIKey is IDEDAMGIXCVPLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16OS4/c1-2-10(11)15-7-12-5-3-4-9-6-13-8-14-9/h2,9H,1,3-8H2.
What are the key properties of S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate?
S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate has a molecular weight of 280.50 g/mol, XLogP of 3.71, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate is sourced from PubChem (CID 22670176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).