C10H16OS4 — CID 22670176
S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate (PubChem CID 22670176) has the molecular formula C10H16OS4 and a molecular weight of 280.50 g/mol. Its IUPAC name is S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate.
| Compound Name | S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate |
|---|---|
| PubChem CID | 22670176 |
| Molecular Formula | C10H16OS4 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | S-[3-(1,3-dithiolan-4-yl)propylsulfanylmethyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCSCCCC1CSCS1 |
| InChI | InChI=1S/C10H16OS4/c1-2-10(11)15-7-12-5-3-4-9-6-13-8-14-9/h2,9H,1,3-8H2 |
| InChIKey | IDEDAMGIXCVPLJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|