C12H16O3S3 — CID 59096091
ethenyl [5-(prop-2-enoylsulfanylmethyl)thiolan-2-yl]methylsulfanylformate (PubChem CID 59096091) has the molecular formula C12H16O3S3 and a molecular weight of 304.46 g/mol. Its IUPAC name is ethenyl [5-(prop-2-enoylsulfanylmethyl)thiolan-2-yl]methylsulfanylformate.
| Compound Name | ethenyl [5-(prop-2-enoylsulfanylmethyl)thiolan-2-yl]methylsulfanylformate |
|---|---|
| PubChem CID | 59096091 |
| Molecular Formula | C12H16O3S3 |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | ethenyl [5-(prop-2-enoylsulfanylmethyl)thiolan-2-yl]methylsulfanylformate |
| SMILES | C=COC(=O)SCC1CCC(CSC(=O)C=C)S1 |
| InChI | InChI=1S/C12H16O3S3/c1-3-11(13)16-7-9-5-6-10(18-9)8-17-12(14)15-4-2/h3-4,9-10H,1-2,5-8H2 |
| InChIKey | XFUJSADTXDBMFS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|