C14H20NO7S- — CID 118070623
6-methoxy-1-methyl-5-[2-(2-methylprop-2-enoylamino)acetyl]oxy-7-oxabicyclo[2.2.1]heptane-2-sulfinate (PubChem CID 118070623) has the molecular formula C14H20NO7S- and a molecular weight of 346.38 g/mol. Its IUPAC name is 6-methoxy-1-methyl-5-[2-(2-methylprop-2-enoylamino)acetyl]oxy-7-oxabicyclo[2.2.1]heptane-2-sulfinate.
| Compound Name | 6-methoxy-1-methyl-5-[2-(2-methylprop-2-enoylamino)acetyl]oxy-7-oxabicyclo[2.2.1]heptane-2-sulfinate |
|---|---|
| PubChem CID | 118070623 |
| Molecular Formula | C14H20NO7S- |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 6-methoxy-1-methyl-5-[2-(2-methylprop-2-enoylamino)acetyl]oxy-7-oxabicyclo[2.2.1]heptane-2-sulfinate |
| SMILES | C=C(C)C(=O)NCC(=O)OC1C2CC(S(=O)[O-])C(C)(O2)C1OC |
| InChI | InChI=1S/C14H21NO7S/c1-7(2)13(17)15-6-10(16)21-11-8-5-9(23(18)19)14(3,22-8)12(11)20-4/h8-9,11-12H,1,5-6H2,2-4H3,(H,15,17)(H,18,19)/p-1 |
| InChIKey | IURQYJBYRMXCRN-UHFFFAOYSA-M |
| XLogP | -0.59 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|