C13H19NO7S — CID 118070642
6-methoxy-6-methyl-5-[2-(prop-2-enoylamino)acetyl]oxy-7-oxabicyclo[2.2.1]heptane-2-sulfinic acid (PubChem CID 118070642) has the molecular formula C13H19NO7S and a molecular weight of 333.36 g/mol. Its IUPAC name is 6-methoxy-6-methyl-5-[2-(prop-2-enoylamino)acetyl]oxy-7-oxabicyclo[2.2.1]heptane-2-sulfinic acid.
| Compound Name | 6-methoxy-6-methyl-5-[2-(prop-2-enoylamino)acetyl]oxy-7-oxabicyclo[2.2.1]heptane-2-sulfinic acid |
|---|---|
| PubChem CID | 118070642 |
| Molecular Formula | C13H19NO7S |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 6-methoxy-6-methyl-5-[2-(prop-2-enoylamino)acetyl]oxy-7-oxabicyclo[2.2.1]heptane-2-sulfinic acid |
| SMILES | C=CC(=O)NCC(=O)OC1C2CC(S(=O)O)C(O2)C1(C)OC |
| InChI | InChI=1S/C13H19NO7S/c1-4-9(15)14-6-10(16)21-11-7-5-8(22(17)18)12(20-7)13(11,2)19-3/h4,7-8,11-12H,1,5-6H2,2-3H3,(H,14,15)(H,17,18) |
| InChIKey | ZOKFIYMJOWZJJN-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|