C20H31NO3 — CID 58186194
[5-methyl-2-(2-methylpropyl)-2-adamantyl] 2-(prop-2-enoylamino)acetate (PubChem CID 58186194) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is [5-methyl-2-(2-methylpropyl)-2-adamantyl] 2-(prop-2-enoylamino)acetate.
| Compound Name | [5-methyl-2-(2-methylpropyl)-2-adamantyl] 2-(prop-2-enoylamino)acetate |
|---|---|
| PubChem CID | 58186194 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | [5-methyl-2-(2-methylpropyl)-2-adamantyl] 2-(prop-2-enoylamino)acetate |
| SMILES | C=CC(=O)NCC(=O)OC1(CC(C)C)C2CC3CC1CC(C)(C3)C2 |
| InChI | InChI=1S/C20H31NO3/c1-5-17(22)21-12-18(23)24-20(8-13(2)3)15-6-14-7-16(20)11-19(4,9-14)10-15/h5,13-16H,1,6-12H2,2-4H3,(H,21,22) |
| InChIKey | OWFGOWSPEMUMJX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|