C20H32O4 — CID 59326423
[2-[(2-ethyl-5-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-methylbutanoate (PubChem CID 59326423) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is [2-[(2-ethyl-5-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-methylbutanoate.
| Compound Name | [2-[(2-ethyl-5-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 59326423 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | [2-[(2-ethyl-5-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC(=O)OC1(CC)C2CC3CC1CC(C)(C3)C2 |
| InChI | InChI=1S/C20H32O4/c1-5-13(3)18(22)23-12-17(21)24-20(6-2)15-7-14-8-16(20)11-19(4,9-14)10-15/h13-16H,5-12H2,1-4H3 |
| InChIKey | BBECFVNDRMRMMR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |