C24H40O4 — CID 59326376
[2-[(2-hexyl-5-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-methylbutanoate (PubChem CID 59326376) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is [2-[(2-hexyl-5-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-methylbutanoate.
| Compound Name | [2-[(2-hexyl-5-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 59326376 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | [2-[(2-hexyl-5-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-methylbutanoate |
| SMILES | CCCCCCC1(OC(=O)COC(=O)C(C)CC)C2CC3CC1CC(C)(C3)C2 |
| InChI | InChI=1S/C24H40O4/c1-5-7-8-9-10-24(28-21(25)16-27-22(26)17(3)6-2)19-11-18-12-20(24)15-23(4,13-18)14-19/h17-20H,5-16H2,1-4H3 |
| InChIKey | CVVBFHGUDMGUBZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|