C44H68O4 — CID 69157393
bis(2-hexyl-2-adamantyl) adamantane-1,3-dicarboxylate (PubChem CID 69157393) has the molecular formula C44H68O4 and a molecular weight of 661.02 g/mol. Its IUPAC name is bis(2-hexyl-2-adamantyl) adamantane-1,3-dicarboxylate.
| Compound Name | bis(2-hexyl-2-adamantyl) adamantane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 69157393 |
| Molecular Formula | C44H68O4 |
| Molecular Weight | 661.02 g/mol |
| Exact Mass | 660.51 |
| IUPAC Name | bis(2-hexyl-2-adamantyl) adamantane-1,3-dicarboxylate |
| SMILES | CCCCCCC1(OC(=O)C23CC4CC(C2)CC(C(=O)OC2(CCCCCC)C5CC6CC(C5)CC2C6)(C4)C3)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C44H68O4/c1-3-5-7-9-11-43(35-16-29-13-30(18-35)19-36(43)17-29)47-39(45)41-24-33-15-34(25-41)27-42(26-33,28-41)40(46)48-44(12-10-8-6-4-2)37-20-31-14-32(22-37)23-38(44)21-31/h29-38H,3-28H2,1-2H3 |
| InChIKey | AGAOPIJTLOQSJN-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.02 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|