C40H56O8 — CID 69156203
bis[2-(2-ethoxy-2-oxoethyl)-2-adamantyl] adamantane-1,3-dicarboxylate (PubChem CID 69156203) has the molecular formula C40H56O8 and a molecular weight of 664.88 g/mol. Its IUPAC name is bis[2-(2-ethoxy-2-oxoethyl)-2-adamantyl] adamantane-1,3-dicarboxylate.
| Compound Name | bis[2-(2-ethoxy-2-oxoethyl)-2-adamantyl] adamantane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 69156203 |
| Molecular Formula | C40H56O8 |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 664.40 |
| IUPAC Name | bis[2-(2-ethoxy-2-oxoethyl)-2-adamantyl] adamantane-1,3-dicarboxylate |
| SMILES | CCOC(=O)CC1(OC(=O)C23CC4CC(C2)CC(C(=O)OC2(CC(=O)OCC)C5CC6CC(C5)CC2C6)(C4)C3)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C40H56O8/c1-3-45-33(41)20-39(29-8-23-5-24(10-29)11-30(39)9-23)47-35(43)37-16-27-7-28(17-37)19-38(18-27,22-37)36(44)48-40(21-34(42)46-4-2)31-12-25-6-26(14-31)15-32(40)13-25/h23-32H,3-22H2,1-2H3 |
| InChIKey | CISQOSNWNUTJTI-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|