About bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate
bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate (PubChem CID 69156202) has the molecular formula C42H64O4
and a molecular weight of 632.97 g/mol. Its IUPAC name is bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate |
| PubChem CID | 69156202 |
| Molecular Formula | C42H64O4 |
| Molecular Weight | 632.97 g/mol |
| Exact Mass | 632.48 |
| IUPAC Name | bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate |
| SMILES | CCCCCC1(OC(=O)C23CC4CC(C2)CC(C(=O)OC2(CCCCC)C5CC6CC(C5)CC2C6)(C4)C3)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C42H64O4/c1-3-5-7-9-41(33-14-27-11-28(16-33)17-34(41)15-27)45-37(43)39-22-31-13-32(23-39)25-40(24-31,26-39)38(44)46-42(10-8-6-4-2)35-18-29-12-30(20-35)21-36(42)19-29/h27-36H,3-26H2,1-2H3 |
| InChIKey | IMULZRJHRBRIKU-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 632.97 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate?
The IUPAC name of bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate (CID 69156202) is bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate.
What is the SMILES notation for bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate?
The canonical SMILES for bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate is CCCCCC1(OC(=O)C23CC4CC(C2)CC(C(=O)OC2(CCCCC)C5CC6CC(C5)CC2C6)(C4)C3)C2CC3CC(C2)CC1C3.
What is the InChIKey of bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate?
The InChIKey is IMULZRJHRBRIKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H64O4/c1-3-5-7-9-41(33-14-27-11-28(16-33)17-34(41)15-27)45-37(43)39-22-31-13-32(23-39)25-40(24-31,26-39)38(44)46-42(10-8-6-4-2)35-18-29-12-30(20-35)21-36(42)19-29/h27-36H,3-26H2,1-2H3.
What are the key properties of bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate?
bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate has a molecular weight of 632.97 g/mol, XLogP of 10.21, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-pentyl-2-adamantyl) adamantane-1,3-dicarboxylate is sourced from PubChem (CID 69156202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).