C23H37NO3 — CID 58186231
[5-methyl-2-(2-methylpropyl)-2-adamantyl] 5-(prop-2-enoylamino)pentanoate (PubChem CID 58186231) has the molecular formula C23H37NO3 and a molecular weight of 375.55 g/mol. Its IUPAC name is [5-methyl-2-(2-methylpropyl)-2-adamantyl] 5-(prop-2-enoylamino)pentanoate.
| Compound Name | [5-methyl-2-(2-methylpropyl)-2-adamantyl] 5-(prop-2-enoylamino)pentanoate |
|---|---|
| PubChem CID | 58186231 |
| Molecular Formula | C23H37NO3 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.28 |
| IUPAC Name | [5-methyl-2-(2-methylpropyl)-2-adamantyl] 5-(prop-2-enoylamino)pentanoate |
| SMILES | C=CC(=O)NCCCCC(=O)OC1(CC(C)C)C2CC3CC1CC(C)(C3)C2 |
| InChI | InChI=1S/C23H37NO3/c1-5-20(25)24-9-7-6-8-21(26)27-23(12-16(2)3)18-10-17-11-19(23)15-22(4,13-17)14-18/h5,16-19H,1,6-15H2,2-4H3,(H,24,25) |
| InChIKey | XXEXZRZPLREJCY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|