C15H22NO6S- — CID 118070692
6-methoxy-5-methyl-3-[2-(2-methylprop-2-enoylamino)acetyl]oxybicyclo[2.2.1]heptane-2-sulfinate (PubChem CID 118070692) has the molecular formula C15H22NO6S- and a molecular weight of 344.41 g/mol. Its IUPAC name is 6-methoxy-5-methyl-3-[2-(2-methylprop-2-enoylamino)acetyl]oxybicyclo[2.2.1]heptane-2-sulfinate.
| Compound Name | 6-methoxy-5-methyl-3-[2-(2-methylprop-2-enoylamino)acetyl]oxybicyclo[2.2.1]heptane-2-sulfinate |
|---|---|
| PubChem CID | 118070692 |
| Molecular Formula | C15H22NO6S- |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 6-methoxy-5-methyl-3-[2-(2-methylprop-2-enoylamino)acetyl]oxybicyclo[2.2.1]heptane-2-sulfinate |
| SMILES | C=C(C)C(=O)NCC(=O)OC1C2CC(C(OC)C2C)C1S(=O)[O-] |
| InChI | InChI=1S/C15H23NO6S/c1-7(2)15(18)16-6-11(17)22-13-9-5-10(14(13)23(19)20)12(21-4)8(9)3/h8-10,12-14H,1,5-6H2,2-4H3,(H,16,18)(H,19,20)/p-1 |
| InChIKey | HBQFNRNEOSGOJD-UHFFFAOYSA-M |
| XLogP | 0.14 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|