C10H21NO3Si — CID 173192018
N-(4-dimethoxysilylbutyl)-2-methylprop-2-enamide (PubChem CID 173192018) has the molecular formula C10H21NO3Si and a molecular weight of 231.37 g/mol. Its IUPAC name is N-(4-dimethoxysilylbutyl)-2-methylprop-2-enamide.
| Compound Name | N-(4-dimethoxysilylbutyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 173192018 |
| Molecular Formula | C10H21NO3Si |
| Molecular Weight | 231.37 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-(4-dimethoxysilylbutyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCC[SiH](OC)OC |
| InChI | InChI=1S/C10H21NO3Si/c1-9(2)10(12)11-7-5-6-8-15(13-3)14-4/h15H,1,5-8H2,2-4H3,(H,11,12) |
| InChIKey | YWWZYEWDHDJNQE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|