C19H28F2O2 — CID 158300716
(5-cyclohexyl-2-adamantyl) 2,2-difluoropropanoate (PubChem CID 158300716) has the molecular formula C19H28F2O2 and a molecular weight of 326.43 g/mol. Its IUPAC name is (5-cyclohexyl-2-adamantyl) 2,2-difluoropropanoate.
| Compound Name | (5-cyclohexyl-2-adamantyl) 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 158300716 |
| Molecular Formula | C19H28F2O2 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (5-cyclohexyl-2-adamantyl) 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OC1C2CC3CC1CC(C1CCCCC1)(C3)C2 |
| InChI | InChI=1S/C19H28F2O2/c1-18(20,21)17(22)23-16-13-7-12-8-14(16)11-19(9-12,10-13)15-5-3-2-4-6-15/h12-16H,2-11H2,1H3 |
| InChIKey | YZKYUWLOZJAKOV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |