C20H24F2O2 — CID 157160499
[5-(4-methylphenyl)-2-adamantyl] 2,2-difluoropropanoate (PubChem CID 157160499) has the molecular formula C20H24F2O2 and a molecular weight of 334.41 g/mol. Its IUPAC name is [5-(4-methylphenyl)-2-adamantyl] 2,2-difluoropropanoate.
| Compound Name | [5-(4-methylphenyl)-2-adamantyl] 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 157160499 |
| Molecular Formula | C20H24F2O2 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | [5-(4-methylphenyl)-2-adamantyl] 2,2-difluoropropanoate |
| SMILES | Cc1ccc(C23CC4CC(C2)C(OC(=O)C(C)(F)F)C(C4)C3)cc1 |
| InChI | InChI=1S/C20H24F2O2/c1-12-3-5-16(6-4-12)20-9-13-7-14(10-20)17(15(8-13)11-20)24-18(23)19(2,21)22/h3-6,13-15,17H,7-11H2,1-2H3 |
| InChIKey | KJNUVGZBPCIKIR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |