C22H34F2O4 — CID 89089877
[5-(cyclohexylmethoxymethoxy)-2-adamantyl] 2,2-difluorobutanoate (PubChem CID 89089877) has the molecular formula C22H34F2O4 and a molecular weight of 400.51 g/mol. Its IUPAC name is [5-(cyclohexylmethoxymethoxy)-2-adamantyl] 2,2-difluorobutanoate.
| Compound Name | [5-(cyclohexylmethoxymethoxy)-2-adamantyl] 2,2-difluorobutanoate |
|---|---|
| PubChem CID | 89089877 |
| Molecular Formula | C22H34F2O4 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | [5-(cyclohexylmethoxymethoxy)-2-adamantyl] 2,2-difluorobutanoate |
| SMILES | CCC(F)(F)C(=O)OC1C2CC3CC1CC(OCOCC1CCCCC1)(C3)C2 |
| InChI | InChI=1S/C22H34F2O4/c1-2-22(23,24)20(25)28-19-17-8-16-9-18(19)12-21(10-16,11-17)27-14-26-13-15-6-4-3-5-7-15/h15-19H,2-14H2,1H3 |
| InChIKey | VHGBGCKDNXERHX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|