C16H22O8S3 — CID 159266945
(5,5-dioxo-4-oxa-5λ6,8-dithiatricyclo[4.2.1.03,7]nonan-2-yl) 2-[2-(2,2-dimethylbutanoylsulfanyl)acetyl]oxyacetate (PubChem CID 159266945) has the molecular formula C16H22O8S3 and a molecular weight of 438.55 g/mol. Its IUPAC name is (5,5-dioxo-4-oxa-5λ6,8-dithiatricyclo[4.2.1.03,7]nonan-2-yl) 2-[2-(2,2-dimethylbutanoylsulfanyl)acetyl]oxyacetate.
| Compound Name | (5,5-dioxo-4-oxa-5λ6,8-dithiatricyclo[4.2.1.03,7]nonan-2-yl) 2-[2-(2,2-dimethylbutanoylsulfanyl)acetyl]oxyacetate |
|---|---|
| PubChem CID | 159266945 |
| Molecular Formula | C16H22O8S3 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | (5,5-dioxo-4-oxa-5λ6,8-dithiatricyclo[4.2.1.03,7]nonan-2-yl) 2-[2-(2,2-dimethylbutanoylsulfanyl)acetyl]oxyacetate |
| SMILES | CCC(C)(C)C(=O)SCC(=O)OCC(=O)OC1C2CC3C(S2)C1OS3(=O)=O |
| InChI | InChI=1S/C16H22O8S3/c1-4-16(2,3)15(19)25-7-11(18)22-6-10(17)23-12-8-5-9-14(26-8)13(12)24-27(9,20)21/h8-9,12-14H,4-7H2,1-3H3 |
| InChIKey | IKUPOFSIBMPUFP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|