C13H20O3S — CID 99975491
(4R,5S,9S,11R)-4-methyl-2-oxa-3λ6-thiatetracyclo[7.3.1.17,11.01,5]tetradecane 3,3-dioxide (PubChem CID 99975491) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is (4R,5S,9S,11R)-4-methyl-2-oxa-3λ6-thiatetracyclo[7.3.1.17,11.01,5]tetradecane 3,3-dioxide.
| Compound Name | (4R,5S,9S,11R)-4-methyl-2-oxa-3λ6-thiatetracyclo[7.3.1.17,11.01,5]tetradecane 3,3-dioxide |
|---|---|
| PubChem CID | 99975491 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (4R,5S,9S,11R)-4-methyl-2-oxa-3λ6-thiatetracyclo[7.3.1.17,11.01,5]tetradecane 3,3-dioxide |
| SMILES | C[C@@H]1[C@H]2CC3C[C@@H]4C[C@H](C3)CC2(C4)OS1(=O)=O |
| InChI | InChI=1S/C13H20O3S/c1-8-12-5-9-2-10-4-11(3-9)7-13(12,6-10)16-17(8,14)15/h8-12H,2-7H2,1H3/t8-,9?,10-,11+,12-,13?/m1/s1 |
| InChIKey | XRDLIOJNINEUQK-QDEWEPPJSA-N |
| XLogP | 2.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|