C9H16O4S — CID 147494307
5-ethyl-3,3a-dimethyl-3,5,6,6a-tetrahydrofuro[3,2-c]oxathiole 1,1-dioxide (PubChem CID 147494307) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is 5-ethyl-3,3a-dimethyl-3,5,6,6a-tetrahydrofuro[3,2-c]oxathiole 1,1-dioxide.
| Compound Name | 5-ethyl-3,3a-dimethyl-3,5,6,6a-tetrahydrofuro[3,2-c]oxathiole 1,1-dioxide |
|---|---|
| PubChem CID | 147494307 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 5-ethyl-3,3a-dimethyl-3,5,6,6a-tetrahydrofuro[3,2-c]oxathiole 1,1-dioxide |
| SMILES | CCC1CC2C(C)(O1)C(C)OS2(=O)=O |
| InChI | InChI=1S/C9H16O4S/c1-4-7-5-8-9(3,12-7)6(2)13-14(8,10)11/h6-8H,4-5H2,1-3H3 |
| InChIKey | FGDKDBIFIUPVRM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|