About (1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide
(1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide (PubChem CID 118070644) has the molecular formula C10H16O2S
and a molecular weight of 200.30 g/mol. Its IUPAC name is (1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide.
Analyze (1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide?
The IUPAC name of (1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide (CID 118070644) is (1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide.
What is the SMILES notation for (1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide?
The canonical SMILES for (1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide is CC1C2C3(C)C[C@H]1C[C@H]3CS2(=O)=O.
What is the InChIKey of (1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide?
The InChIKey is DHTSFQPDXMANLN-RGJLLFKYSA-N. The full InChI is InChI=1S/C10H16O2S/c1-6-7-3-8-5-13(11,12)9(6)10(8,2)4-7/h6-9H,3-5H2,1-2H3/t6?,7-,8+,9?,10?/m1/s1.
What are the key properties of (1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide?
(1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide has a molecular weight of 200.30 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6R)-2,7-dimethyl-4λ6-thiatricyclo[4.2.1.03,7]nonane 4,4-dioxide is sourced from PubChem (CID 118070644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).