C12H16F2O8S — CID 88965768
1,1-difluoro-2-[[5-(1-hydroxyethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl]methoxy]-2-oxoethanesulfonic acid (PubChem CID 88965768) has the molecular formula C12H16F2O8S and a molecular weight of 358.32 g/mol. Its IUPAC name is 1,1-difluoro-2-[[5-(1-hydroxyethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl]methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[5-(1-hydroxyethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl]methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88965768 |
| Molecular Formula | C12H16F2O8S |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 1,1-difluoro-2-[[5-(1-hydroxyethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl]methoxy]-2-oxoethanesulfonic acid |
| SMILES | CC(O)C1CC2CC(=O)OC2C1COC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C12H16F2O8S/c1-5(15)7-2-6-3-9(16)22-10(6)8(7)4-21-11(17)12(13,14)23(18,19)20/h5-8,10,15H,2-4H2,1H3,(H,18,19,20) |
| InChIKey | YBPVHKBIDRBEKV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|