C17H28F2O6S — CID 89433596
3-[2-(1-ethylcyclooctyl)oxycarbonylprop-2-enoxy]-1,1-difluoropropane-1-sulfonic acid (PubChem CID 89433596) has the molecular formula C17H28F2O6S and a molecular weight of 398.47 g/mol. Its IUPAC name is 3-[2-(1-ethylcyclooctyl)oxycarbonylprop-2-enoxy]-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 3-[2-(1-ethylcyclooctyl)oxycarbonylprop-2-enoxy]-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 89433596 |
| Molecular Formula | C17H28F2O6S |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-[2-(1-ethylcyclooctyl)oxycarbonylprop-2-enoxy]-1,1-difluoropropane-1-sulfonic acid |
| SMILES | C=C(COCCC(F)(F)S(=O)(=O)O)C(=O)OC1(CC)CCCCCCC1 |
| InChI | InChI=1S/C17H28F2O6S/c1-3-16(9-7-5-4-6-8-10-16)25-15(20)14(2)13-24-12-11-17(18,19)26(21,22)23/h2-13H2,1H3,(H,21,22,23) |
| InChIKey | QTQSNCYEQIEJHF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|