C13H16F6O3 — CID 166810519
[1-cyclopentyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butan-2-yl] prop-2-enoate (PubChem CID 166810519) has the molecular formula C13H16F6O3 and a molecular weight of 334.26 g/mol. Its IUPAC name is [1-cyclopentyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butan-2-yl] prop-2-enoate.
| Compound Name | [1-cyclopentyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 166810519 |
| Molecular Formula | C13H16F6O3 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [1-cyclopentyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(CC1CCCC1)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H16F6O3/c1-2-10(20)22-9(7-8-5-3-4-6-8)11(21,12(14,15)16)13(17,18)19/h2,8-9,21H,1,3-7H2 |
| InChIKey | HEHAJEYFYWNMQK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|