C12H17F3O3 — CID 118679863
[2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] prop-2-enoate (PubChem CID 118679863) has the molecular formula C12H17F3O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] prop-2-enoate.
| Compound Name | [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] prop-2-enoate |
|---|---|
| PubChem CID | 118679863 |
| Molecular Formula | C12H17F3O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CCCCC1C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C12H17F3O3/c1-3-10(16)18-9-7-5-4-6-8(9)11(2,17)12(13,14)15/h3,8-9,17H,1,4-7H2,2H3 |
| InChIKey | SZHGMFJIUIGGHI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|