C14H21F5O7S — CID 118231755
1,1-difluoro-2-[2-(1,1,1-trifluoro-2-hydroxy-2,5-dimethylhexan-3-yl)oxycarbonylprop-2-enoxy]ethanesulfonic acid (PubChem CID 118231755) has the molecular formula C14H21F5O7S and a molecular weight of 428.37 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-(1,1,1-trifluoro-2-hydroxy-2,5-dimethylhexan-3-yl)oxycarbonylprop-2-enoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-(1,1,1-trifluoro-2-hydroxy-2,5-dimethylhexan-3-yl)oxycarbonylprop-2-enoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 118231755 |
| Molecular Formula | C14H21F5O7S |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 1,1-difluoro-2-[2-(1,1,1-trifluoro-2-hydroxy-2,5-dimethylhexan-3-yl)oxycarbonylprop-2-enoxy]ethanesulfonic acid |
| SMILES | C=C(COCC(F)(F)S(=O)(=O)O)C(=O)OC(CC(C)C)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C14H21F5O7S/c1-8(2)5-10(12(4,21)14(17,18)19)26-11(20)9(3)6-25-7-13(15,16)27(22,23)24/h8,10,21H,3,5-7H2,1-2,4H3,(H,22,23,24) |
| InChIKey | IEDWJPKYMZAHKH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|