C11H9F9O8S — CID 161079237
1,1-difluoro-2-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-(1,1,1-trifluoropropan-2-yloxy)propan-2-yl]oxyethanesulfonic acid (PubChem CID 161079237) has the molecular formula C11H9F9O8S and a molecular weight of 472.23 g/mol. Its IUPAC name is 1,1-difluoro-2-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-(1,1,1-trifluoropropan-2-yloxy)propan-2-yl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-(1,1,1-trifluoropropan-2-yloxy)propan-2-yl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 161079237 |
| Molecular Formula | C11H9F9O8S |
| Molecular Weight | 472.23 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | 1,1-difluoro-2-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-(1,1,1-trifluoropropan-2-yloxy)propan-2-yl]oxyethanesulfonic acid |
| SMILES | C=C(F)C(=O)OC(OCC(F)(F)S(=O)(=O)O)(C(=O)OC(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H9F9O8S/c1-4(12)6(21)28-9(11(18,19)20,7(22)27-5(2)10(15,16)17)26-3-8(13,14)29(23,24)25/h5H,1,3H2,2H3,(H,23,24,25) |
| InChIKey | ALNMHGMHGAGRFM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|