C11H11F8NO7S — CID 158298860
1,1-difluoro-2-[1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxy-3-(1,1,1-trifluoropropan-2-ylamino)propan-2-yl]oxyethanesulfonic acid (PubChem CID 158298860) has the molecular formula C11H11F8NO7S and a molecular weight of 453.26 g/mol. Its IUPAC name is 1,1-difluoro-2-[1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxy-3-(1,1,1-trifluoropropan-2-ylamino)propan-2-yl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxy-3-(1,1,1-trifluoropropan-2-ylamino)propan-2-yl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 158298860 |
| Molecular Formula | C11H11F8NO7S |
| Molecular Weight | 453.26 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | 1,1-difluoro-2-[1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxy-3-(1,1,1-trifluoropropan-2-ylamino)propan-2-yl]oxyethanesulfonic acid |
| SMILES | C=CC(=O)OC(OCC(F)(F)S(=O)(=O)O)(C(=O)NC(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H11F8NO7S/c1-3-6(21)27-9(11(17,18)19,7(22)20-5(2)10(14,15)16)26-4-8(12,13)28(23,24)25/h3,5H,1,4H2,2H3,(H,20,22)(H,23,24,25) |
| InChIKey | LETDOUXCDJERMG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|