C12H18F2O8S — CID 118231702
1,1-difluoro-2-[2-(2-hydroxy-2-methyloxan-4-yl)oxycarbonylprop-2-enoxy]ethanesulfonic acid (PubChem CID 118231702) has the molecular formula C12H18F2O8S and a molecular weight of 360.33 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-(2-hydroxy-2-methyloxan-4-yl)oxycarbonylprop-2-enoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-(2-hydroxy-2-methyloxan-4-yl)oxycarbonylprop-2-enoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 118231702 |
| Molecular Formula | C12H18F2O8S |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 1,1-difluoro-2-[2-(2-hydroxy-2-methyloxan-4-yl)oxycarbonylprop-2-enoxy]ethanesulfonic acid |
| SMILES | C=C(COCC(F)(F)S(=O)(=O)O)C(=O)OC1CCOC(C)(O)C1 |
| InChI | InChI=1S/C12H18F2O8S/c1-8(6-20-7-12(13,14)23(17,18)19)10(15)22-9-3-4-21-11(2,16)5-9/h9,16H,1,3-7H2,2H3,(H,17,18,19) |
| InChIKey | LQVIOEYMHXPNKB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|