C14H22F2O6S — CID 88910465
1,1-difluoro-2-[(5-hydroxy-7-methoxy-2-adamantyl)methoxy]ethanesulfonic acid (PubChem CID 88910465) has the molecular formula C14H22F2O6S and a molecular weight of 356.39 g/mol. Its IUPAC name is 1,1-difluoro-2-[(5-hydroxy-7-methoxy-2-adamantyl)methoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(5-hydroxy-7-methoxy-2-adamantyl)methoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 88910465 |
| Molecular Formula | C14H22F2O6S |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1,1-difluoro-2-[(5-hydroxy-7-methoxy-2-adamantyl)methoxy]ethanesulfonic acid |
| SMILES | COC12CC3CC(O)(CC(C1)C3COCC(F)(F)S(=O)(=O)O)C2 |
| InChI | InChI=1S/C14H22F2O6S/c1-21-13-4-9-2-12(17,7-13)3-10(5-13)11(9)6-22-8-14(15,16)23(18,19)20/h9-11,17H,2-8H2,1H3,(H,18,19,20) |
| InChIKey | JLHKPNKYSCBZGC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|