About oxan-4-yl 2-methylidenepentanoate
oxan-4-yl 2-methylidenepentanoate (PubChem CID 162744191) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is oxan-4-yl 2-methylidenepentanoate.
Molecular Properties
| Compound Name | oxan-4-yl 2-methylidenepentanoate |
| PubChem CID | 162744191 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | oxan-4-yl 2-methylidenepentanoate |
| SMILES | C=C(CCC)C(=O)OC1CCOCC1 |
| InChI | InChI=1S/C11H18O3/c1-3-4-9(2)11(12)14-10-5-7-13-8-6-10/h10H,2-8H2,1H3 |
| InChIKey | CVBHZLRJQYIOGC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze oxan-4-yl 2-methylidenepentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl 2-methylidenepentanoate?
The IUPAC name of oxan-4-yl 2-methylidenepentanoate (CID 162744191) is oxan-4-yl 2-methylidenepentanoate.
What is the SMILES notation for oxan-4-yl 2-methylidenepentanoate?
The canonical SMILES for oxan-4-yl 2-methylidenepentanoate is C=C(CCC)C(=O)OC1CCOCC1.
What is the InChIKey of oxan-4-yl 2-methylidenepentanoate?
The InChIKey is CVBHZLRJQYIOGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-3-4-9(2)11(12)14-10-5-7-13-8-6-10/h10H,2-8H2,1H3.
What are the key properties of oxan-4-yl 2-methylidenepentanoate?
oxan-4-yl 2-methylidenepentanoate has a molecular weight of 198.26 g/mol, XLogP of 2.06, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl 2-methylidenepentanoate is sourced from PubChem (CID 162744191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).