About oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate
oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 126699796) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate.
Molecular Properties
| Compound Name | oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate |
| PubChem CID | 126699796 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OC1CCOC1 |
| InChI | InChI=1S/C8H12O4/c1-6(4-9)8(10)12-7-2-3-11-5-7/h7,9H,1-5H2 |
| InChIKey | ZUSDRKUIJKJHKF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate?
The IUPAC name of oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate (CID 126699796) is oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate.
What is the SMILES notation for oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate?
The canonical SMILES for oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate is C=C(CO)C(=O)OC1CCOC1.
What is the InChIKey of oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate?
The InChIKey is ZUSDRKUIJKJHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-6(4-9)8(10)12-7-2-3-11-5-7/h7,9H,1-5H2.
What are the key properties of oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate?
oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate has a molecular weight of 172.18 g/mol, XLogP of -0.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl 2-(hydroxymethyl)prop-2-enoate is sourced from PubChem (CID 126699796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).