About oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate
oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate (PubChem CID 80749674) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate.
Molecular Properties
| Compound Name | oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate |
| PubChem CID | 80749674 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate |
| SMILES | N[C@H](CO)C(=O)OC1CCOC1 |
| InChI | InChI=1S/C7H13NO4/c8-6(3-9)7(10)12-5-1-2-11-4-5/h5-6,9H,1-4,8H2/t5?,6-/m1/s1 |
| InChIKey | DFHYKTNJZYTBMY-PRJDIBJQSA-N |
| XLogP | -1.36 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate?
The IUPAC name of oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate (CID 80749674) is oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate.
What is the SMILES notation for oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate?
The canonical SMILES for oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate is N[C@H](CO)C(=O)OC1CCOC1.
What is the InChIKey of oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate?
The InChIKey is DFHYKTNJZYTBMY-PRJDIBJQSA-N. The full InChI is InChI=1S/C7H13NO4/c8-6(3-9)7(10)12-5-1-2-11-4-5/h5-6,9H,1-4,8H2/t5?,6-/m1/s1.
What are the key properties of oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate?
oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate has a molecular weight of 175.18 g/mol, XLogP of -1.36, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl (2R)-2-amino-3-hydroxypropanoate is sourced from PubChem (CID 80749674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).