About oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate
oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate (PubChem CID 122539257) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate.
Molecular Properties
| Compound Name | oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate |
| PubChem CID | 122539257 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate |
| SMILES | CC(C)(O)C(N)C(=O)OC1CCOC1 |
| InChI | InChI=1S/C9H17NO4/c1-9(2,12)7(10)8(11)14-6-3-4-13-5-6/h6-7,12H,3-5,10H2,1-2H3 |
| InChIKey | RCDWMYFNJGALMM-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate?
The IUPAC name of oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate (CID 122539257) is oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate.
What is the SMILES notation for oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate?
The canonical SMILES for oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate is CC(C)(O)C(N)C(=O)OC1CCOC1.
What is the InChIKey of oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate?
The InChIKey is RCDWMYFNJGALMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-9(2,12)7(10)8(11)14-6-3-4-13-5-6/h6-7,12H,3-5,10H2,1-2H3.
What are the key properties of oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate?
oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate has a molecular weight of 203.24 g/mol, XLogP of -0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl 2-amino-3-hydroxy-3-methylbutanoate is sourced from PubChem (CID 122539257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).