About 1-(oxan-4-yl)hexan-3-one
1-(oxan-4-yl)hexan-3-one (PubChem CID 62385519) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-(oxan-4-yl)hexan-3-one.
Molecular Properties
| Compound Name | 1-(oxan-4-yl)hexan-3-one |
| PubChem CID | 62385519 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 1-(oxan-4-yl)hexan-3-one |
| SMILES | CCCC(=O)CCC1CCOCC1 |
| InChI | InChI=1S/C11H20O2/c1-2-3-11(12)5-4-10-6-8-13-9-7-10/h10H,2-9H2,1H3 |
| InChIKey | MOTQAZDKWPOCJT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(oxan-4-yl)hexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-4-yl)hexan-3-one?
The IUPAC name of 1-(oxan-4-yl)hexan-3-one (CID 62385519) is 1-(oxan-4-yl)hexan-3-one.
What is the SMILES notation for 1-(oxan-4-yl)hexan-3-one?
The canonical SMILES for 1-(oxan-4-yl)hexan-3-one is CCCC(=O)CCC1CCOCC1.
What is the InChIKey of 1-(oxan-4-yl)hexan-3-one?
The InChIKey is MOTQAZDKWPOCJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-2-3-11(12)5-4-10-6-8-13-9-7-10/h10H,2-9H2,1H3.
What are the key properties of 1-(oxan-4-yl)hexan-3-one?
1-(oxan-4-yl)hexan-3-one has a molecular weight of 184.28 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-4-yl)hexan-3-one is sourced from PubChem (CID 62385519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).