C13H21F3O2 — CID 114191929
1,1,1-trifluoro-8-(oxan-4-yl)octan-4-one (PubChem CID 114191929) has the molecular formula C13H21F3O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-8-(oxan-4-yl)octan-4-one.
| Compound Name | 1,1,1-trifluoro-8-(oxan-4-yl)octan-4-one |
|---|---|
| PubChem CID | 114191929 |
| Molecular Formula | C13H21F3O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1,1,1-trifluoro-8-(oxan-4-yl)octan-4-one |
| SMILES | O=C(CCCCC1CCOCC1)CCC(F)(F)F |
| InChI | InChI=1S/C13H21F3O2/c14-13(15,16)8-5-12(17)4-2-1-3-11-6-9-18-10-7-11/h11H,1-10H2 |
| InChIKey | KWRDXMASXKQBPQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|