C12H18F4O2 — CID 114193017
1,1,2,2-tetrafluoro-7-(oxan-4-yl)heptan-3-one (PubChem CID 114193017) has the molecular formula C12H18F4O2 and a molecular weight of 270.27 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-7-(oxan-4-yl)heptan-3-one.
| Compound Name | 1,1,2,2-tetrafluoro-7-(oxan-4-yl)heptan-3-one |
|---|---|
| PubChem CID | 114193017 |
| Molecular Formula | C12H18F4O2 |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1,1,2,2-tetrafluoro-7-(oxan-4-yl)heptan-3-one |
| SMILES | O=C(CCCCC1CCOCC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H18F4O2/c13-11(14)12(15,16)10(17)4-2-1-3-9-5-7-18-8-6-9/h9,11H,1-8H2 |
| InChIKey | FXPKVBCMJYYMPL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|