About 4-(oxan-4-yl)butyl propanoate
4-(oxan-4-yl)butyl propanoate (PubChem CID 142409107) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is 4-(oxan-4-yl)butyl propanoate.
Molecular Properties
| Compound Name | 4-(oxan-4-yl)butyl propanoate |
| PubChem CID | 142409107 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 4-(oxan-4-yl)butyl propanoate |
| SMILES | CCC(=O)OCCCCC1CCOCC1 |
| InChI | InChI=1S/C12H22O3/c1-2-12(13)15-8-4-3-5-11-6-9-14-10-7-11/h11H,2-10H2,1H3 |
| InChIKey | NPLRVVZIHDKHJQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(oxan-4-yl)butyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxan-4-yl)butyl propanoate?
The IUPAC name of 4-(oxan-4-yl)butyl propanoate (CID 142409107) is 4-(oxan-4-yl)butyl propanoate.
What is the SMILES notation for 4-(oxan-4-yl)butyl propanoate?
The canonical SMILES for 4-(oxan-4-yl)butyl propanoate is CCC(=O)OCCCCC1CCOCC1.
What is the InChIKey of 4-(oxan-4-yl)butyl propanoate?
The InChIKey is NPLRVVZIHDKHJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-2-12(13)15-8-4-3-5-11-6-9-14-10-7-11/h11H,2-10H2,1H3.
What are the key properties of 4-(oxan-4-yl)butyl propanoate?
4-(oxan-4-yl)butyl propanoate has a molecular weight of 214.30 g/mol, XLogP of 2.54, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxan-4-yl)butyl propanoate is sourced from PubChem (CID 142409107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).