About 5-cyclopropylpentanoyl chloride
5-cyclopropylpentanoyl chloride (PubChem CID 21489686) has the molecular formula C8H13ClO
and a molecular weight of 160.64 g/mol. Its IUPAC name is 5-cyclopropylpentanoyl chloride.
Molecular Properties
| Compound Name | 5-cyclopropylpentanoyl chloride |
| PubChem CID | 21489686 |
| Molecular Formula | C8H13ClO |
| Molecular Weight | 160.64 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 5-cyclopropylpentanoyl chloride |
| SMILES | O=C(Cl)CCCCC1CC1 |
| InChI | InChI=1S/C8H13ClO/c9-8(10)4-2-1-3-7-5-6-7/h7H,1-6H2 |
| InChIKey | FIEUWBBKDVDTJL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.64 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopropylpentanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropylpentanoyl chloride?
The IUPAC name of 5-cyclopropylpentanoyl chloride (CID 21489686) is 5-cyclopropylpentanoyl chloride.
What is the SMILES notation for 5-cyclopropylpentanoyl chloride?
The canonical SMILES for 5-cyclopropylpentanoyl chloride is O=C(Cl)CCCCC1CC1.
What is the InChIKey of 5-cyclopropylpentanoyl chloride?
The InChIKey is FIEUWBBKDVDTJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClO/c9-8(10)4-2-1-3-7-5-6-7/h7H,1-6H2.
What are the key properties of 5-cyclopropylpentanoyl chloride?
5-cyclopropylpentanoyl chloride has a molecular weight of 160.64 g/mol, XLogP of 2.72, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropylpentanoyl chloride is sourced from PubChem (CID 21489686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).