C19H20F4O8S — CID 122674409
1,1,2,2-tetrafluoro-6-[2-[(2-oxo-3,4-dihydrochromen-6-yl)oxycarbonyl]prop-2-enoxy]hexane-1-sulfonic acid (PubChem CID 122674409) has the molecular formula C19H20F4O8S and a molecular weight of 484.42 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-[2-[(2-oxo-3,4-dihydrochromen-6-yl)oxycarbonyl]prop-2-enoxy]hexane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-6-[2-[(2-oxo-3,4-dihydrochromen-6-yl)oxycarbonyl]prop-2-enoxy]hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 122674409 |
| Molecular Formula | C19H20F4O8S |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-[2-[(2-oxo-3,4-dihydrochromen-6-yl)oxycarbonyl]prop-2-enoxy]hexane-1-sulfonic acid |
| SMILES | C=C(COCCCCC(F)(F)C(F)(F)S(=O)(=O)O)C(=O)Oc1ccc2c(c1)CCC(=O)O2 |
| InChI | InChI=1S/C19H20F4O8S/c1-12(11-29-9-3-2-8-18(20,21)19(22,23)32(26,27)28)17(25)30-14-5-6-15-13(10-14)4-7-16(24)31-15/h5-6,10H,1-4,7-9,11H2,(H,26,27,28) |
| InChIKey | BRQSIZLGVLBFIV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|