C17H16O4 — CID 142101371
benzene;(2-oxo-3,4-dihydrochromen-6-yl) acetate (PubChem CID 142101371) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is benzene;(2-oxo-3,4-dihydrochromen-6-yl) acetate.
| Compound Name | benzene;(2-oxo-3,4-dihydrochromen-6-yl) acetate |
|---|---|
| PubChem CID | 142101371 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | benzene;(2-oxo-3,4-dihydrochromen-6-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CCC(=O)O2.c1ccccc1 |
| InChI | InChI=1S/C11H10O4.C6H6/c1-7(12)14-9-3-4-10-8(6-9)2-5-11(13)15-10;1-2-4-6-5-3-1/h3-4,6H,2,5H2,1H3;1-6H |
| InChIKey | HYXLBWYDGLEHRN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|