C11H10O3 — CID 14614729
6-acetyl-3,4-dihydrochromen-2-one (PubChem CID 14614729) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is 6-acetyl-3,4-dihydrochromen-2-one.
| Compound Name | 6-acetyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 14614729 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 6-acetyl-3,4-dihydrochromen-2-one |
| SMILES | CC(=O)c1ccc2c(c1)CCC(=O)O2 |
| InChI | InChI=1S/C11H10O3/c1-7(12)8-2-4-10-9(6-8)3-5-11(13)14-10/h2,4,6H,3,5H2,1H3 |
| InChIKey | FKCFGIPTIUMBPX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|