C12H11NO2 — CID 59035984
1-(2-isocyano-3,4-dihydro-2H-chromen-6-yl)ethanone (PubChem CID 59035984) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is 1-(2-isocyano-3,4-dihydro-2H-chromen-6-yl)ethanone.
| Compound Name | 1-(2-isocyano-3,4-dihydro-2H-chromen-6-yl)ethanone |
|---|---|
| PubChem CID | 59035984 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1-(2-isocyano-3,4-dihydro-2H-chromen-6-yl)ethanone |
| SMILES | [C-]#[N+]C1CCc2cc(C(C)=O)ccc2O1 |
| InChI | InChI=1S/C12H11NO2/c1-8(14)9-3-5-11-10(7-9)4-6-12(13-2)15-11/h3,5,7,12H,4,6H2,1H3 |
| InChIKey | UXHKCIXPEZCCAN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|